C22H39N3O2 — CID 130208797
3-(6,8,9-tritert-butyl-1,3,4,8-tetrahydropyrazino[1,2-c]pyrimidin-2-yl)propanoic acid (PubChem CID 130208797) has the molecular formula C22H39N3O2 and a molecular weight of 377.57 g/mol. Its IUPAC name is 3-(6,8,9-tritert-butyl-1,3,4,8-tetrahydropyrazino[1,2-c]pyrimidin-2-yl)propanoic acid.
| Compound Name | 3-(6,8,9-tritert-butyl-1,3,4,8-tetrahydropyrazino[1,2-c]pyrimidin-2-yl)propanoic acid |
|---|---|
| PubChem CID | 130208797 |
| Molecular Formula | C22H39N3O2 |
| Molecular Weight | 377.57 g/mol |
| Exact Mass | 377.30 |
| IUPAC Name | 3-(6,8,9-tritert-butyl-1,3,4,8-tetrahydropyrazino[1,2-c]pyrimidin-2-yl)propanoic acid |
| SMILES | CC(C)(C)C1=NC(C(C)(C)C)C(C(C)(C)C)=C2CN(CCC(=O)O)CCN12 |
| InChI | InChI=1S/C22H39N3O2/c1-20(2,3)17-15-14-24(11-10-16(26)27)12-13-25(15)19(22(7,8)9)23-18(17)21(4,5)6/h18H,10-14H2,1-9H3,(H,26,27) |
| InChIKey | NNBMPZCVQJJSKW-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 56.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.57 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |