C23H39N3O2 — CID 130208661
1-(1,3,4-tritert-butyl-3,5,6,7-tetrahydropyrrolo[1,2-c]pyrimidin-5-yl)azetidine-3-carboxylic acid (PubChem CID 130208661) has the molecular formula C23H39N3O2 and a molecular weight of 389.58 g/mol. Its IUPAC name is 1-(1,3,4-tritert-butyl-3,5,6,7-tetrahydropyrrolo[1,2-c]pyrimidin-5-yl)azetidine-3-carboxylic acid.
| Compound Name | 1-(1,3,4-tritert-butyl-3,5,6,7-tetrahydropyrrolo[1,2-c]pyrimidin-5-yl)azetidine-3-carboxylic acid |
|---|---|
| PubChem CID | 130208661 |
| Molecular Formula | C23H39N3O2 |
| Molecular Weight | 389.58 g/mol |
| Exact Mass | 389.30 |
| IUPAC Name | 1-(1,3,4-tritert-butyl-3,5,6,7-tetrahydropyrrolo[1,2-c]pyrimidin-5-yl)azetidine-3-carboxylic acid |
| SMILES | CC(C)(C)C1=NC(C(C)(C)C)C(C(C)(C)C)=C2C(N3CC(C(=O)O)C3)CCN12 |
| InChI | InChI=1S/C23H39N3O2/c1-21(2,3)16-17-15(25-12-14(13-25)19(27)28)10-11-26(17)20(23(7,8)9)24-18(16)22(4,5)6/h14-15,18H,10-13H2,1-9H3,(H,27,28) |
| InChIKey | JTQAKYCNCSNRBW-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 56.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.58 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |