C22H37N3O2 — CID 130208972
methyl 1-[(3S,6S)-1,4-ditert-butyl-3-methyl-3,5,6,7-tetrahydropyrrolo[1,2-c]pyrimidin-6-yl]pyrrolidine-2-carboxylate (PubChem CID 130208972) has the molecular formula C22H37N3O2 and a molecular weight of 375.56 g/mol. Its IUPAC name is methyl 1-[(3S,6S)-1,4-ditert-butyl-3-methyl-3,5,6,7-tetrahydropyrrolo[1,2-c]pyrimidin-6-yl]pyrrolidine-2-carboxylate.
| Compound Name | methyl 1-[(3S,6S)-1,4-ditert-butyl-3-methyl-3,5,6,7-tetrahydropyrrolo[1,2-c]pyrimidin-6-yl]pyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 130208972 |
| Molecular Formula | C22H37N3O2 |
| Molecular Weight | 375.56 g/mol |
| Exact Mass | 375.29 |
| IUPAC Name | methyl 1-[(3S,6S)-1,4-ditert-butyl-3-methyl-3,5,6,7-tetrahydropyrrolo[1,2-c]pyrimidin-6-yl]pyrrolidine-2-carboxylate |
| SMILES | COC(=O)C1CCCN1[C@H]1CC2=C(C(C)(C)C)[C@H](C)N=C(C(C)(C)C)N2C1 |
| InChI | InChI=1S/C22H37N3O2/c1-14-18(21(2,3)4)17-12-15(13-25(17)20(23-14)22(5,6)7)24-11-9-10-16(24)19(26)27-8/h14-16H,9-13H2,1-8H3/t14-,15-,16?/m0/s1 |
| InChIKey | LUULVUHJSAWUMS-KSCSMHSMSA-N |
| XLogP | 3.85 |
| TPSA | 45.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.56 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |