C8H16N2O2S — CID 59337380
N,4,5-trimethyl-3,6-dihydro-2H-pyridine-1-sulfonamide (PubChem CID 59337380) has the molecular formula C8H16N2O2S and a molecular weight of 204.29 g/mol. Its IUPAC name is N,4,5-trimethyl-3,6-dihydro-2H-pyridine-1-sulfonamide.
| Compound Name | N,4,5-trimethyl-3,6-dihydro-2H-pyridine-1-sulfonamide |
|---|---|
| PubChem CID | 59337380 |
| Molecular Formula | C8H16N2O2S |
| Molecular Weight | 204.29 g/mol |
| Exact Mass | 204.09 |
| IUPAC Name | N,4,5-trimethyl-3,6-dihydro-2H-pyridine-1-sulfonamide |
| SMILES | CNS(=O)(=O)N1CCC(C)=C(C)C1 |
| InChI | InChI=1S/C8H16N2O2S/c1-7-4-5-10(6-8(7)2)13(11,12)9-3/h9H,4-6H2,1-3H3 |
| InChIKey | UHTSWEBQYPVBRS-UHFFFAOYSA-N |
| XLogP | 0.49 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.29 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|