C15H18F2N4O2S2 — CID 126757193
methyl 6-[2,2-difluoroethyl(methylsulfanyl)amino]-1-(1,3-thiazol-2-yl)-3,5,6,7-tetrahydropyrrolo[1,2-c]pyrimidine-4-carboxylate (PubChem CID 126757193) has the molecular formula C15H18F2N4O2S2 and a molecular weight of 388.47 g/mol. Its IUPAC name is methyl 6-[2,2-difluoroethyl(methylsulfanyl)amino]-1-(1,3-thiazol-2-yl)-3,5,6,7-tetrahydropyrrolo[1,2-c]pyrimidine-4-carboxylate.
| Compound Name | methyl 6-[2,2-difluoroethyl(methylsulfanyl)amino]-1-(1,3-thiazol-2-yl)-3,5,6,7-tetrahydropyrrolo[1,2-c]pyrimidine-4-carboxylate |
|---|---|
| PubChem CID | 126757193 |
| Molecular Formula | C15H18F2N4O2S2 |
| Molecular Weight | 388.47 g/mol |
| Exact Mass | 388.08 |
| IUPAC Name | methyl 6-[2,2-difluoroethyl(methylsulfanyl)amino]-1-(1,3-thiazol-2-yl)-3,5,6,7-tetrahydropyrrolo[1,2-c]pyrimidine-4-carboxylate |
| SMILES | COC(=O)C1=C2CC(N(CC(F)F)SC)CN2C(c2nccs2)=NC1 |
| InChI | InChI=1S/C15H18F2N4O2S2/c1-23-15(22)10-6-19-13(14-18-3-4-25-14)20-7-9(5-11(10)20)21(24-2)8-12(16)17/h3-4,9,12H,5-8H2,1-2H3 |
| InChIKey | QGZPXFLWOWSANC-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 58.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.47 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|