C22H26BrFN4O2S — CID 135159599
ethyl (3R,6R)-3-[(2Z,4E)-3-bromo-5-fluorohepta-2,4,6-trien-2-yl]-6-(dimethylamino)-1-(1,3-thiazol-2-yl)-3,5,6,7-tetrahydropyrrolo[1,2-c]pyrimidine-4-carboxylate (PubChem CID 135159599) has the molecular formula C22H26BrFN4O2S and a molecular weight of 509.45 g/mol. Its IUPAC name is ethyl (3R,6R)-3-[(2Z,4E)-3-bromo-5-fluorohepta-2,4,6-trien-2-yl]-6-(dimethylamino)-1-(1,3-thiazol-2-yl)-3,5,6,7-tetrahydropyrrolo[1,2-c]pyrimidine-4-carboxylate.
| Compound Name | ethyl (3R,6R)-3-[(2Z,4E)-3-bromo-5-fluorohepta-2,4,6-trien-2-yl]-6-(dimethylamino)-1-(1,3-thiazol-2-yl)-3,5,6,7-tetrahydropyrrolo[1,2-c]pyrimidine-4-carboxylate |
|---|---|
| PubChem CID | 135159599 |
| Molecular Formula | C22H26BrFN4O2S |
| Molecular Weight | 509.45 g/mol |
| Exact Mass | 508.09 |
| IUPAC Name | ethyl (3R,6R)-3-[(2Z,4E)-3-bromo-5-fluorohepta-2,4,6-trien-2-yl]-6-(dimethylamino)-1-(1,3-thiazol-2-yl)-3,5,6,7-tetrahydropyrrolo[1,2-c]pyrimidine-4-carboxylate |
| SMILES | C=C/C(F)=C\C(Br)=C(/C)[C@@H]1N=C(c2nccs2)N2C[C@H](N(C)C)CC2=C1C(=O)OCC |
| InChI | InChI=1S/C22H26BrFN4O2S/c1-6-14(24)10-16(23)13(3)19-18(22(29)30-7-2)17-11-15(27(4)5)12-28(17)20(26-19)21-25-8-9-31-21/h6,8-10,15,19H,1,7,11-12H2,2-5H3/b14-10+,16-13-/t15-,19+/m1/s1 |
| InChIKey | NZBNEMXWKTUMQJ-BRVRKTGRSA-N |
| XLogP | 4.43 |
| TPSA | 58.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.45 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|