C22H26ClFN4O4S2 — CID 135159841
methyl (3R,6S)-3-[(3Z,5Z)-3-chloro-2-fluorohepta-1,3,5-trien-4-yl]-6-(ethylsulfonylamino)-1-(1,3-thiazol-2-ylmethyl)-3,5,6,7-tetrahydropyrrolo[1,2-c]pyrimidine-4-carboxylate (PubChem CID 135159841) has the molecular formula C22H26ClFN4O4S2 and a molecular weight of 529.06 g/mol. Its IUPAC name is methyl (3R,6S)-3-[(3Z,5Z)-3-chloro-2-fluorohepta-1,3,5-trien-4-yl]-6-(ethylsulfonylamino)-1-(1,3-thiazol-2-ylmethyl)-3,5,6,7-tetrahydropyrrolo[1,2-c]pyrimidine-4-carboxylate.
| Compound Name | methyl (3R,6S)-3-[(3Z,5Z)-3-chloro-2-fluorohepta-1,3,5-trien-4-yl]-6-(ethylsulfonylamino)-1-(1,3-thiazol-2-ylmethyl)-3,5,6,7-tetrahydropyrrolo[1,2-c]pyrimidine-4-carboxylate |
|---|---|
| PubChem CID | 135159841 |
| Molecular Formula | C22H26ClFN4O4S2 |
| Molecular Weight | 529.06 g/mol |
| Exact Mass | 528.11 |
| IUPAC Name | methyl (3R,6S)-3-[(3Z,5Z)-3-chloro-2-fluorohepta-1,3,5-trien-4-yl]-6-(ethylsulfonylamino)-1-(1,3-thiazol-2-ylmethyl)-3,5,6,7-tetrahydropyrrolo[1,2-c]pyrimidine-4-carboxylate |
| SMILES | C=C(F)/C(Cl)=C(\C=C/C)[C@@H]1N=C(Cc2nccs2)N2C[C@@H](NS(=O)(=O)CC)CC2=C1C(=O)OC |
| InChI | InChI=1S/C22H26ClFN4O4S2/c1-5-7-15(20(23)13(3)24)21-19(22(29)32-4)16-10-14(27-34(30,31)6-2)12-28(16)17(26-21)11-18-25-8-9-33-18/h5,7-9,14,21,27H,3,6,10-12H2,1-2,4H3/b7-5-,20-15-/t14-,21-/m0/s1 |
| InChIKey | QEEUFQFUGCCBND-WHVSVORMSA-N |
| XLogP | 3.46 |
| TPSA | 100.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.06 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|