C18H19BrFN3O2S — CID 153412192
ethyl 6-(bromomethyl)-4-[(3Z)-5-fluorohexa-1,3,5-trien-2-yl]-4-methyl-2-(1,3-thiazol-2-yl)-1H-pyrimidine-5-carboxylate (PubChem CID 153412192) has the molecular formula C18H19BrFN3O2S and a molecular weight of 440.34 g/mol. Its IUPAC name is ethyl 6-(bromomethyl)-4-[(3Z)-5-fluorohexa-1,3,5-trien-2-yl]-4-methyl-2-(1,3-thiazol-2-yl)-1H-pyrimidine-5-carboxylate.
| Compound Name | ethyl 6-(bromomethyl)-4-[(3Z)-5-fluorohexa-1,3,5-trien-2-yl]-4-methyl-2-(1,3-thiazol-2-yl)-1H-pyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 153412192 |
| Molecular Formula | C18H19BrFN3O2S |
| Molecular Weight | 440.34 g/mol |
| Exact Mass | 439.04 |
| IUPAC Name | ethyl 6-(bromomethyl)-4-[(3Z)-5-fluorohexa-1,3,5-trien-2-yl]-4-methyl-2-(1,3-thiazol-2-yl)-1H-pyrimidine-5-carboxylate |
| SMILES | C=C(F)/C=C\C(=C)C1(C)N=C(c2nccs2)NC(CBr)=C1C(=O)OCC |
| InChI | InChI=1S/C18H19BrFN3O2S/c1-5-25-17(24)14-13(10-19)22-15(16-21-8-9-26-16)23-18(14,4)11(2)6-7-12(3)20/h6-9H,2-3,5,10H2,1,4H3,(H,22,23)/b7-6- |
| InChIKey | XUTLUZFNIYEGQZ-SREVYHEPSA-N |
| XLogP | 4.06 |
| TPSA | 63.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.34 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|