C24H31F3O6S — CID 126761405
[(3'S,3aS,6R,6'S,7aS)-3a,6',7a-trimethyl-7-(2-oxoethyl)-3-(trifluoromethylsulfonyloxy)spiro[1,4,5,7-tetrahydroindene-6,7'-bicyclo[4.2.0]oct-1(8)-ene]-3'-yl] acetate (PubChem CID 126761405) has the molecular formula C24H31F3O6S and a molecular weight of 504.57 g/mol. Its IUPAC name is [(3'S,3aS,6R,6'S,7aS)-3a,6',7a-trimethyl-7-(2-oxoethyl)-3-(trifluoromethylsulfonyloxy)spiro[1,4,5,7-tetrahydroindene-6,7'-bicyclo[4.2.0]oct-1(8)-ene]-3'-yl] acetate.
| Compound Name | [(3'S,3aS,6R,6'S,7aS)-3a,6',7a-trimethyl-7-(2-oxoethyl)-3-(trifluoromethylsulfonyloxy)spiro[1,4,5,7-tetrahydroindene-6,7'-bicyclo[4.2.0]oct-1(8)-ene]-3'-yl] acetate |
|---|---|
| PubChem CID | 126761405 |
| Molecular Formula | C24H31F3O6S |
| Molecular Weight | 504.57 g/mol |
| Exact Mass | 504.18 |
| IUPAC Name | [(3'S,3aS,6R,6'S,7aS)-3a,6',7a-trimethyl-7-(2-oxoethyl)-3-(trifluoromethylsulfonyloxy)spiro[1,4,5,7-tetrahydroindene-6,7'-bicyclo[4.2.0]oct-1(8)-ene]-3'-yl] acetate |
| SMILES | CC(=O)O[C@H]1CC[C@@]2(C)C(=C[C@@]23CC[C@]2(C)C(OS(=O)(=O)C(F)(F)F)=CC[C@@]2(C)C3CC=O)C1 |
| InChI | InChI=1S/C24H31F3O6S/c1-15(29)32-17-5-8-20(2)16(13-17)14-23(20)11-10-22(4)19(33-34(30,31)24(25,26)27)6-9-21(22,3)18(23)7-12-28/h6,12,14,17-18H,5,7-11,13H2,1-4H3/t17-,18?,20-,21-,22+,23+/m0/s1 |
| InChIKey | UNNGPOUABHYJOG-MFRHMOEASA-N |
| XLogP | 5.20 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.57 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|