C29H34F3N2O2+ — CID 163268290
[(9S,14R)-3-acetyloxy-9,10,13-trimethyl-17-[4-(trifluoromethyl)-3-pyridinyl]-2,3,4,7,8,11,12,15-octahydro-1H-cyclopenta[a]phenanthren-14-yl]-methylidyneazanium (PubChem CID 163268290) has the molecular formula C29H34F3N2O2+ and a molecular weight of 499.60 g/mol. Its IUPAC name is [(9S,14R)-3-acetyloxy-9,10,13-trimethyl-17-[4-(trifluoromethyl)-3-pyridinyl]-2,3,4,7,8,11,12,15-octahydro-1H-cyclopenta[a]phenanthren-14-yl]-methylidyneazanium.
| Compound Name | [(9S,14R)-3-acetyloxy-9,10,13-trimethyl-17-[4-(trifluoromethyl)-3-pyridinyl]-2,3,4,7,8,11,12,15-octahydro-1H-cyclopenta[a]phenanthren-14-yl]-methylidyneazanium |
|---|---|
| PubChem CID | 163268290 |
| Molecular Formula | C29H34F3N2O2+ |
| Molecular Weight | 499.60 g/mol |
| Exact Mass | 499.26 |
| IUPAC Name | [(9S,14R)-3-acetyloxy-9,10,13-trimethyl-17-[4-(trifluoromethyl)-3-pyridinyl]-2,3,4,7,8,11,12,15-octahydro-1H-cyclopenta[a]phenanthren-14-yl]-methylidyneazanium |
| SMILES | C#[N+][C@@]12CC=C(c3cnccc3C(F)(F)F)C1(C)CC[C@@]1(C)C2CC=C2CC(OC(C)=O)CCC21C |
| InChI | InChI=1S/C29H34F3N2O2/c1-18(35)36-20-8-11-25(2)19(16-20)6-7-24-27(25,4)14-13-26(3)22(9-12-28(24,26)33-5)21-17-34-15-10-23(21)29(30,31)32/h5-6,9-10,15,17,20,24H,7-8,11-14,16H2,1-4H3/q+1/t20?,24?,25?,26?,27-,28+/m0/s1 |
| InChIKey | TUDBTDVUAIXIEH-OZZGIJEMSA-N |
| XLogP | 7.46 |
| TPSA | 43.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.60 |
| LogP ≤ 5 | 7.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|