C27H33FN2O4 — CID 118618047
(2-amino-2-oxoethyl) [(3S,8R,9S,10R,13R)-14-fluoro-10,13-dimethyl-17-pyridin-3-yl-1,2,3,4,7,8,9,11,12,15-decahydrocyclopenta[a]phenanthren-3-yl] carbonate (PubChem CID 118618047) has the molecular formula C27H33FN2O4 and a molecular weight of 468.57 g/mol. Its IUPAC name is (2-amino-2-oxoethyl) [(3S,8R,9S,10R,13R)-14-fluoro-10,13-dimethyl-17-pyridin-3-yl-1,2,3,4,7,8,9,11,12,15-decahydrocyclopenta[a]phenanthren-3-yl] carbonate.
| Compound Name | (2-amino-2-oxoethyl) [(3S,8R,9S,10R,13R)-14-fluoro-10,13-dimethyl-17-pyridin-3-yl-1,2,3,4,7,8,9,11,12,15-decahydrocyclopenta[a]phenanthren-3-yl] carbonate |
|---|---|
| PubChem CID | 118618047 |
| Molecular Formula | C27H33FN2O4 |
| Molecular Weight | 468.57 g/mol |
| Exact Mass | 468.24 |
| IUPAC Name | (2-amino-2-oxoethyl) [(3S,8R,9S,10R,13R)-14-fluoro-10,13-dimethyl-17-pyridin-3-yl-1,2,3,4,7,8,9,11,12,15-decahydrocyclopenta[a]phenanthren-3-yl] carbonate |
| SMILES | C[C@]12CC[C@H](OC(=O)OCC(N)=O)CC1=CC[C@@H]1[C@@H]2CC[C@]2(C)C(c3cccnc3)=CCC12F |
| InChI | InChI=1S/C27H33FN2O4/c1-25-10-7-19(34-24(32)33-16-23(29)31)14-18(25)5-6-22-21(25)8-11-26(2)20(9-12-27(22,26)28)17-4-3-13-30-15-17/h3-5,9,13,15,19,21-22H,6-8,10-12,14,16H2,1-2H3,(H2,29,31)/t19-,21-,22+,25-,26+,27?/m0/s1 |
| InChIKey | HGWWVBAEUAJTGJ-MVPMLOKFSA-N |
| XLogP | 5.14 |
| TPSA | 91.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.57 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|