C27H33N2O2+ — CID 163445664
[(3S,8R,9S,10R,13R,14R)-3-acetyloxy-10,13-dimethyl-17-pyridin-3-yl-1,2,3,4,7,8,9,11,12,15-decahydrocyclopenta[a]phenanthren-14-yl]-methylidyneazanium (PubChem CID 163445664) has the molecular formula C27H33N2O2+ and a molecular weight of 417.57 g/mol. Its IUPAC name is [(3S,8R,9S,10R,13R,14R)-3-acetyloxy-10,13-dimethyl-17-pyridin-3-yl-1,2,3,4,7,8,9,11,12,15-decahydrocyclopenta[a]phenanthren-14-yl]-methylidyneazanium.
| Compound Name | [(3S,8R,9S,10R,13R,14R)-3-acetyloxy-10,13-dimethyl-17-pyridin-3-yl-1,2,3,4,7,8,9,11,12,15-decahydrocyclopenta[a]phenanthren-14-yl]-methylidyneazanium |
|---|---|
| PubChem CID | 163445664 |
| Molecular Formula | C27H33N2O2+ |
| Molecular Weight | 417.57 g/mol |
| Exact Mass | 417.25 |
| IUPAC Name | [(3S,8R,9S,10R,13R,14R)-3-acetyloxy-10,13-dimethyl-17-pyridin-3-yl-1,2,3,4,7,8,9,11,12,15-decahydrocyclopenta[a]phenanthren-14-yl]-methylidyneazanium |
| SMILES | C#[N+][C@@]12CC=C(c3cccnc3)[C@@]1(C)CC[C@H]1[C@H]2CC=C2C[C@@H](OC(C)=O)CC[C@@]21C |
| InChI | InChI=1S/C27H33N2O2/c1-18(30)31-21-9-12-25(2)20(16-21)7-8-24-23(25)10-13-26(3)22(11-14-27(24,26)28-4)19-6-5-15-29-17-19/h4-7,11,15,17,21,23-24H,8-10,12-14,16H2,1-3H3/q+1/t21-,23-,24+,25-,26+,27+/m0/s1 |
| InChIKey | FQZUITCKJLSIBP-VKVVYBDYSA-N |
| XLogP | 6.05 |
| TPSA | 43.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.57 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|