C33H41NO5S — CID 86582960
[(3S,8R,9S,10R,13S,14S)-10,13-dimethyl-17-pyridin-3-yl-2,3,4,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthren-3-yl] acetate;4-methylbenzenesulfonic acid (PubChem CID 86582960) has the molecular formula C33H41NO5S and a molecular weight of 563.76 g/mol. Its IUPAC name is [(3S,8R,9S,10R,13S,14S)-10,13-dimethyl-17-pyridin-3-yl-2,3,4,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthren-3-yl] acetate;4-methylbenzenesulfonic acid.
| Compound Name | [(3S,8R,9S,10R,13S,14S)-10,13-dimethyl-17-pyridin-3-yl-2,3,4,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthren-3-yl] acetate;4-methylbenzenesulfonic acid |
|---|---|
| PubChem CID | 86582960 |
| Molecular Formula | C33H41NO5S |
| Molecular Weight | 563.76 g/mol |
| Exact Mass | 563.27 |
| IUPAC Name | [(3S,8R,9S,10R,13S,14S)-10,13-dimethyl-17-pyridin-3-yl-2,3,4,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthren-3-yl] acetate;4-methylbenzenesulfonic acid |
| SMILES | CC(=O)O[C@H]1CC[C@@]2(C)C(=CC[C@@H]3[C@@H]2CC[C@]2(C)C(c4cccnc4)=CC[C@@H]32)C1.Cc1ccc(S(=O)(=O)O)cc1 |
| InChI | InChI=1S/C26H33NO2.C7H8O3S/c1-17(28)29-20-10-12-25(2)19(15-20)6-7-21-23-9-8-22(18-5-4-14-27-16-18)26(23,3)13-11-24(21)25;1-6-2-4-7(5-3-6)11(8,9)10/h4-6,8,14,16,20-21,23-24H,7,9-13,15H2,1-3H3;2-5H,1H3,(H,8,9,10)/t20-,21-,23-,24-,25-,26+;/m0./s1 |
| InChIKey | OEOHGJUAZPSIHO-AXUALZGKSA-N |
| XLogP | 7.21 |
| TPSA | 93.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.76 |
| LogP ≤ 5 | 7.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|