C28H37NO4 — CID 126761317
[(1S,4R)-4-[(3aS,5S,7aS)-3a,5,7a-trimethyl-4-(2-oxoethyl)-1-pyridin-3-yl-3,4,6,7-tetrahydroinden-5-yl]-4-methyl-3-oxocyclohexyl] acetate (PubChem CID 126761317) has the molecular formula C28H37NO4 and a molecular weight of 451.61 g/mol. Its IUPAC name is [(1S,4R)-4-[(3aS,5S,7aS)-3a,5,7a-trimethyl-4-(2-oxoethyl)-1-pyridin-3-yl-3,4,6,7-tetrahydroinden-5-yl]-4-methyl-3-oxocyclohexyl] acetate.
| Compound Name | [(1S,4R)-4-[(3aS,5S,7aS)-3a,5,7a-trimethyl-4-(2-oxoethyl)-1-pyridin-3-yl-3,4,6,7-tetrahydroinden-5-yl]-4-methyl-3-oxocyclohexyl] acetate |
|---|---|
| PubChem CID | 126761317 |
| Molecular Formula | C28H37NO4 |
| Molecular Weight | 451.61 g/mol |
| Exact Mass | 451.27 |
| IUPAC Name | [(1S,4R)-4-[(3aS,5S,7aS)-3a,5,7a-trimethyl-4-(2-oxoethyl)-1-pyridin-3-yl-3,4,6,7-tetrahydroinden-5-yl]-4-methyl-3-oxocyclohexyl] acetate |
| SMILES | CC(=O)O[C@H]1CC[C@](C)([C@@]2(C)CC[C@]3(C)C(c4cccnc4)=CC[C@@]3(C)C2CC=O)C(=O)C1 |
| InChI | InChI=1S/C28H37NO4/c1-19(31)33-21-8-11-28(5,24(32)17-21)27(4)14-13-25(2)22(20-7-6-15-29-18-20)9-12-26(25,3)23(27)10-16-30/h6-7,9,15-16,18,21,23H,8,10-14,17H2,1-5H3/t21-,23?,25+,26-,27-,28-/m0/s1 |
| InChIKey | PFUROBUGONOBEP-XYKQAQGJSA-N |
| XLogP | 5.58 |
| TPSA | 73.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.61 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|