C27H37NO2 — CID 118858306
(3S,5S,8R,9S,10R,13S,14S)-3-hydroxy-5,9,10,13,14-pentamethyl-17-pyridin-3-yl-2,3,4,7,8,11,12,15-octahydro-1H-cyclopenta[a]phenanthren-6-one (PubChem CID 118858306) has the molecular formula C27H37NO2 and a molecular weight of 407.60 g/mol. Its IUPAC name is (3S,5S,8R,9S,10R,13S,14S)-3-hydroxy-5,9,10,13,14-pentamethyl-17-pyridin-3-yl-2,3,4,7,8,11,12,15-octahydro-1H-cyclopenta[a]phenanthren-6-one.
| Compound Name | (3S,5S,8R,9S,10R,13S,14S)-3-hydroxy-5,9,10,13,14-pentamethyl-17-pyridin-3-yl-2,3,4,7,8,11,12,15-octahydro-1H-cyclopenta[a]phenanthren-6-one |
|---|---|
| PubChem CID | 118858306 |
| Molecular Formula | C27H37NO2 |
| Molecular Weight | 407.60 g/mol |
| Exact Mass | 407.28 |
| IUPAC Name | (3S,5S,8R,9S,10R,13S,14S)-3-hydroxy-5,9,10,13,14-pentamethyl-17-pyridin-3-yl-2,3,4,7,8,11,12,15-octahydro-1H-cyclopenta[a]phenanthren-6-one |
| SMILES | C[C@]12CC[C@H](O)C[C@]1(C)C(=O)C[C@@H]1[C@]2(C)CC[C@]2(C)C(c3cccnc3)=CC[C@@]12C |
| InChI | InChI=1S/C27H37NO2/c1-23-12-13-25(3)21(15-22(30)26(4)16-19(29)8-11-27(25,26)5)24(23,2)10-9-20(23)18-7-6-14-28-17-18/h6-7,9,14,17,19,21,29H,8,10-13,15-16H2,1-5H3/t19-,21-,23+,24-,25-,26+,27+/m0/s1 |
| InChIKey | LXXNDJUYGOLSJW-BISPFIJZSA-N |
| XLogP | 5.83 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.60 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |