C27H37N5O — CID 118861239
(1S,2R,5S,7S,15S,19S)-1,2,7,15,19-pentamethyl-18-pyridin-3-yl-8,9,10,11-tetrazapentacyclo[12.7.0.02,7.08,12.015,19]henicosa-9,11,17-trien-5-ol (PubChem CID 118861239) has the molecular formula C27H37N5O and a molecular weight of 447.63 g/mol. Its IUPAC name is (1S,2R,5S,7S,15S,19S)-1,2,7,15,19-pentamethyl-18-pyridin-3-yl-8,9,10,11-tetrazapentacyclo[12.7.0.02,7.08,12.015,19]henicosa-9,11,17-trien-5-ol.
| Compound Name | (1S,2R,5S,7S,15S,19S)-1,2,7,15,19-pentamethyl-18-pyridin-3-yl-8,9,10,11-tetrazapentacyclo[12.7.0.02,7.08,12.015,19]henicosa-9,11,17-trien-5-ol |
|---|---|
| PubChem CID | 118861239 |
| Molecular Formula | C27H37N5O |
| Molecular Weight | 447.63 g/mol |
| Exact Mass | 447.30 |
| IUPAC Name | (1S,2R,5S,7S,15S,19S)-1,2,7,15,19-pentamethyl-18-pyridin-3-yl-8,9,10,11-tetrazapentacyclo[12.7.0.02,7.08,12.015,19]henicosa-9,11,17-trien-5-ol |
| SMILES | C[C@]12CC[C@H](O)C[C@]1(C)n1nnnc1CC1[C@]2(C)CC[C@]2(C)C(c3cccnc3)=CC[C@@]12C |
| InChI | InChI=1S/C27H37N5O/c1-23-12-13-25(3)21(24(23,2)10-9-20(23)18-7-6-14-28-17-18)15-22-29-30-31-32(22)27(5)16-19(33)8-11-26(25,27)4/h6-7,9,14,17,19,21,33H,8,10-13,15-16H2,1-5H3/t19-,21?,23+,24-,25-,26+,27-/m0/s1 |
| InChIKey | SFCPSGCSGGMNHG-IUKMAEHGSA-N |
| XLogP | 4.81 |
| TPSA | 76.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.63 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |