C16H12F6INO — CID 126763633
2-[[3,5-bis(trifluoromethyl)anilino]methyl]-4-iodo-6-methylphenol (PubChem CID 126763633) has the molecular formula C16H12F6INO and a molecular weight of 475.17 g/mol. Its IUPAC name is 2-[[3,5-bis(trifluoromethyl)anilino]methyl]-4-iodo-6-methylphenol.
| Compound Name | 2-[[3,5-bis(trifluoromethyl)anilino]methyl]-4-iodo-6-methylphenol |
|---|---|
| PubChem CID | 126763633 |
| Molecular Formula | C16H12F6INO |
| Molecular Weight | 475.17 g/mol |
| Exact Mass | 474.99 |
| IUPAC Name | 2-[[3,5-bis(trifluoromethyl)anilino]methyl]-4-iodo-6-methylphenol |
| SMILES | Cc1cc(I)cc(CNc2cc(C(F)(F)F)cc(C(F)(F)F)c2)c1O |
| InChI | InChI=1S/C16H12F6INO/c1-8-2-12(23)3-9(14(8)25)7-24-13-5-10(15(17,18)19)4-11(6-13)16(20,21)22/h2-6,24-25H,7H2,1H3 |
| InChIKey | ZVJRPVQVJSQEBO-UHFFFAOYSA-N |
| XLogP | 5.95 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.17 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|