C18H23N7O2 — CID 126766253
N-(2-ethyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-8-yl)-4-(3-oxopiperazin-1-yl)pyridine-2-carboxamide (PubChem CID 126766253) has the molecular formula C18H23N7O2 and a molecular weight of 369.43 g/mol. Its IUPAC name is N-(2-ethyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-8-yl)-4-(3-oxopiperazin-1-yl)pyridine-2-carboxamide.
| Compound Name | N-(2-ethyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-8-yl)-4-(3-oxopiperazin-1-yl)pyridine-2-carboxamide |
|---|---|
| PubChem CID | 126766253 |
| Molecular Formula | C18H23N7O2 |
| Molecular Weight | 369.43 g/mol |
| Exact Mass | 369.19 |
| IUPAC Name | N-(2-ethyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-8-yl)-4-(3-oxopiperazin-1-yl)pyridine-2-carboxamide |
| SMILES | CCc1nc2n(n1)CCCC2NC(=O)c1cc(N2CCNC(=O)C2)ccn1 |
| InChI | InChI=1S/C18H23N7O2/c1-2-15-22-17-13(4-3-8-25(17)23-15)21-18(27)14-10-12(5-6-19-14)24-9-7-20-16(26)11-24/h5-6,10,13H,2-4,7-9,11H2,1H3,(H,20,26)(H,21,27) |
| InChIKey | HCVVQZMHFPEOTN-UHFFFAOYSA-N |
| XLogP | 0.44 |
| TPSA | 105.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.43 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |