C19H22F3NO4 — CID 126768687
3-[oxan-4-yl-[3-[4-(trifluoromethyl)phenyl]but-2-enoyl]amino]propanoic acid (PubChem CID 126768687) has the molecular formula C19H22F3NO4 and a molecular weight of 385.38 g/mol. Its IUPAC name is 3-[oxan-4-yl-[3-[4-(trifluoromethyl)phenyl]but-2-enoyl]amino]propanoic acid.
| Compound Name | 3-[oxan-4-yl-[3-[4-(trifluoromethyl)phenyl]but-2-enoyl]amino]propanoic acid |
|---|---|
| PubChem CID | 126768687 |
| Molecular Formula | C19H22F3NO4 |
| Molecular Weight | 385.38 g/mol |
| Exact Mass | 385.15 |
| IUPAC Name | 3-[oxan-4-yl-[3-[4-(trifluoromethyl)phenyl]but-2-enoyl]amino]propanoic acid |
| SMILES | CC(=CC(=O)N(CCC(=O)O)C1CCOCC1)c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C19H22F3NO4/c1-13(14-2-4-15(5-3-14)19(20,21)22)12-17(24)23(9-6-18(25)26)16-7-10-27-11-8-16/h2-5,12,16H,6-11H2,1H3,(H,25,26) |
| InChIKey | IFOJBBUBFXKOQF-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.38 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|