About 2-[[5-(dimethylamino)-1,2,4-thiadiazol-3-yl]methoxy]-3-methoxybenzamide
2-[[5-(dimethylamino)-1,2,4-thiadiazol-3-yl]methoxy]-3-methoxybenzamide (PubChem CID 126770222) has the molecular formula C13H16N4O3S
and a molecular weight of 308.36 g/mol. Its IUPAC name is 2-[[5-(dimethylamino)-1,2,4-thiadiazol-3-yl]methoxy]-3-methoxybenzamide.
Molecular Properties
| Compound Name | 2-[[5-(dimethylamino)-1,2,4-thiadiazol-3-yl]methoxy]-3-methoxybenzamide |
| PubChem CID | 126770222 |
| Molecular Formula | C13H16N4O3S |
| Molecular Weight | 308.36 g/mol |
| Exact Mass | 308.09 |
| IUPAC Name | 2-[[5-(dimethylamino)-1,2,4-thiadiazol-3-yl]methoxy]-3-methoxybenzamide |
| SMILES | COc1cccc(C(N)=O)c1OCc1nsc(N(C)C)n1 |
| InChI | InChI=1S/C13H16N4O3S/c1-17(2)13-15-10(16-21-13)7-20-11-8(12(14)18)5-4-6-9(11)19-3/h4-6H,7H2,1-3H3,(H2,14,18) |
| InChIKey | ZDWIYBGTZHKZHU-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 90.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 308.36 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 2-[[5-(dimethylamino)-1,2,4-thiadiazol-3-yl]methoxy]-3-methoxybenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[[5-(dimethylamino)-1,2,4-thiadiazol-3-yl]methoxy]-3-methoxybenzamide?
The IUPAC name of 2-[[5-(dimethylamino)-1,2,4-thiadiazol-3-yl]methoxy]-3-methoxybenzamide (CID 126770222) is 2-[[5-(dimethylamino)-1,2,4-thiadiazol-3-yl]methoxy]-3-methoxybenzamide.
What is the SMILES notation for 2-[[5-(dimethylamino)-1,2,4-thiadiazol-3-yl]methoxy]-3-methoxybenzamide?
The canonical SMILES for 2-[[5-(dimethylamino)-1,2,4-thiadiazol-3-yl]methoxy]-3-methoxybenzamide is COc1cccc(C(N)=O)c1OCc1nsc(N(C)C)n1.
What is the InChIKey of 2-[[5-(dimethylamino)-1,2,4-thiadiazol-3-yl]methoxy]-3-methoxybenzamide?
The InChIKey is ZDWIYBGTZHKZHU-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H16N4O3S/c1-17(2)13-15-10(16-21-13)7-20-11-8(12(14)18)5-4-6-9(11)19-3/h4-6H,7H2,1-3H3,(H2,14,18).
What are the key properties of 2-[[5-(dimethylamino)-1,2,4-thiadiazol-3-yl]methoxy]-3-methoxybenzamide?
2-[[5-(dimethylamino)-1,2,4-thiadiazol-3-yl]methoxy]-3-methoxybenzamide has a molecular weight of 308.36 g/mol, XLogP of 1.29, 6 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[5-(dimethylamino)-1,2,4-thiadiazol-3-yl]methoxy]-3-methoxybenzamide is sourced from PubChem (CID 126770222), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).