C11H12F2N2O2S2 — CID 126770786
1-(difluoromethyl)-2-(2-thiophen-2-ylethylsulfonylmethyl)imidazole (PubChem CID 126770786) has the molecular formula C11H12F2N2O2S2 and a molecular weight of 306.36 g/mol. Its IUPAC name is 1-(difluoromethyl)-2-(2-thiophen-2-ylethylsulfonylmethyl)imidazole.
| Compound Name | 1-(difluoromethyl)-2-(2-thiophen-2-ylethylsulfonylmethyl)imidazole |
|---|---|
| PubChem CID | 126770786 |
| Molecular Formula | C11H12F2N2O2S2 |
| Molecular Weight | 306.36 g/mol |
| Exact Mass | 306.03 |
| IUPAC Name | 1-(difluoromethyl)-2-(2-thiophen-2-ylethylsulfonylmethyl)imidazole |
| SMILES | O=S(=O)(CCc1cccs1)Cc1nccn1C(F)F |
| InChI | InChI=1S/C11H12F2N2O2S2/c12-11(13)15-5-4-14-10(15)8-19(16,17)7-3-9-2-1-6-18-9/h1-2,4-6,11H,3,7-8H2 |
| InChIKey | YYFFXBGBDNKLBH-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 51.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.36 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |