C17H21N5O3S — CID 126782451
3-(cyclopropylmethylsulfamoyl)-N-(5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-yl)benzamide (PubChem CID 126782451) has the molecular formula C17H21N5O3S and a molecular weight of 375.45 g/mol. Its IUPAC name is 3-(cyclopropylmethylsulfamoyl)-N-(5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-yl)benzamide.
| Compound Name | 3-(cyclopropylmethylsulfamoyl)-N-(5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-yl)benzamide |
|---|---|
| PubChem CID | 126782451 |
| Molecular Formula | C17H21N5O3S |
| Molecular Weight | 375.45 g/mol |
| Exact Mass | 375.14 |
| IUPAC Name | 3-(cyclopropylmethylsulfamoyl)-N-(5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-yl)benzamide |
| SMILES | O=C(NC1CCc2ncnn2C1)c1cccc(S(=O)(=O)NCC2CC2)c1 |
| InChI | InChI=1S/C17H21N5O3S/c23-17(21-14-6-7-16-18-11-19-22(16)10-14)13-2-1-3-15(8-13)26(24,25)20-9-12-4-5-12/h1-3,8,11-12,14,20H,4-7,9-10H2,(H,21,23) |
| InChIKey | WTOUJZWXQMSEFE-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 105.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.45 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |