C20H18F3N3O2 — CID 126784188
N-(1H-indol-6-yl)-2-[3-(trifluoromethyl)phenyl]morpholine-4-carboxamide (PubChem CID 126784188) has the molecular formula C20H18F3N3O2 and a molecular weight of 389.38 g/mol. Its IUPAC name is N-(1H-indol-6-yl)-2-[3-(trifluoromethyl)phenyl]morpholine-4-carboxamide.
| Compound Name | N-(1H-indol-6-yl)-2-[3-(trifluoromethyl)phenyl]morpholine-4-carboxamide |
|---|---|
| PubChem CID | 126784188 |
| Molecular Formula | C20H18F3N3O2 |
| Molecular Weight | 389.38 g/mol |
| Exact Mass | 389.14 |
| IUPAC Name | N-(1H-indol-6-yl)-2-[3-(trifluoromethyl)phenyl]morpholine-4-carboxamide |
| SMILES | O=C(Nc1ccc2cc[nH]c2c1)N1CCOC(c2cccc(C(F)(F)F)c2)C1 |
| InChI | InChI=1S/C20H18F3N3O2/c21-20(22,23)15-3-1-2-14(10-15)18-12-26(8-9-28-18)19(27)25-16-5-4-13-6-7-24-17(13)11-16/h1-7,10-11,18,24H,8-9,12H2,(H,25,27) |
| InChIKey | TWIGTZZQQOVRAI-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 57.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.38 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |