C19H26F3N3O3 — CID 167823753
N-(1-ethylpiperidin-3-yl)oxy-2-[3-(trifluoromethyl)phenyl]morpholine-4-carboxamide (PubChem CID 167823753) has the molecular formula C19H26F3N3O3 and a molecular weight of 401.43 g/mol. Its IUPAC name is N-(1-ethylpiperidin-3-yl)oxy-2-[3-(trifluoromethyl)phenyl]morpholine-4-carboxamide.
| Compound Name | N-(1-ethylpiperidin-3-yl)oxy-2-[3-(trifluoromethyl)phenyl]morpholine-4-carboxamide |
|---|---|
| PubChem CID | 167823753 |
| Molecular Formula | C19H26F3N3O3 |
| Molecular Weight | 401.43 g/mol |
| Exact Mass | 401.19 |
| IUPAC Name | N-(1-ethylpiperidin-3-yl)oxy-2-[3-(trifluoromethyl)phenyl]morpholine-4-carboxamide |
| SMILES | CCN1CCCC(ONC(=O)N2CCOC(c3cccc(C(F)(F)F)c3)C2)C1 |
| InChI | InChI=1S/C19H26F3N3O3/c1-2-24-8-4-7-16(12-24)28-23-18(26)25-9-10-27-17(13-25)14-5-3-6-15(11-14)19(20,21)22/h3,5-6,11,16-17H,2,4,7-10,12-13H2,1H3,(H,23,26) |
| InChIKey | HTYQGGSMDJVEKU-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 54.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.43 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|