C13H8Br2N2O2S — CID 12678674
2,4-dibromo-9-methyl-1-nitro-10H-phenothiazine (PubChem CID 12678674) has the molecular formula C13H8Br2N2O2S and a molecular weight of 416.09 g/mol. Its IUPAC name is 2,4-dibromo-9-methyl-1-nitro-10H-phenothiazine.
| Compound Name | 2,4-dibromo-9-methyl-1-nitro-10H-phenothiazine |
|---|---|
| PubChem CID | 12678674 |
| Molecular Formula | C13H8Br2N2O2S |
| Molecular Weight | 416.09 g/mol |
| Exact Mass | 413.87 |
| IUPAC Name | 2,4-dibromo-9-methyl-1-nitro-10H-phenothiazine |
| SMILES | Cc1cccc2c1Nc1c(c(Br)cc(Br)c1[N+](=O)[O-])S2 |
| InChI | InChI=1S/C13H8Br2N2O2S/c1-6-3-2-4-9-10(6)16-11-12(17(18)19)7(14)5-8(15)13(11)20-9/h2-5,16H,1H3 |
| InChIKey | SOHFIABKBKFVGI-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 55.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.09 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|