C16H19N3OS — CID 126787255
N-(cyclohexylmethyl)-N-pyridin-2-yl-1,3-thiazole-4-carboxamide (PubChem CID 126787255) has the molecular formula C16H19N3OS and a molecular weight of 301.41 g/mol. Its IUPAC name is N-(cyclohexylmethyl)-N-pyridin-2-yl-1,3-thiazole-4-carboxamide.
| Compound Name | N-(cyclohexylmethyl)-N-pyridin-2-yl-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 126787255 |
| Molecular Formula | C16H19N3OS |
| Molecular Weight | 301.41 g/mol |
| Exact Mass | 301.12 |
| IUPAC Name | N-(cyclohexylmethyl)-N-pyridin-2-yl-1,3-thiazole-4-carboxamide |
| SMILES | O=C(c1cscn1)N(CC1CCCCC1)c1ccccn1 |
| InChI | InChI=1S/C16H19N3OS/c20-16(14-11-21-12-18-14)19(15-8-4-5-9-17-15)10-13-6-2-1-3-7-13/h4-5,8-9,11-13H,1-3,6-7,10H2 |
| InChIKey | RPOSQWNMKOYQMB-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 46.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.41 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |