C8H11F3N2O2 — CID 126789274
N-(1-acetylazetidin-3-yl)-3,3,3-trifluoropropanamide (PubChem CID 126789274) has the molecular formula C8H11F3N2O2 and a molecular weight of 224.18 g/mol. Its IUPAC name is N-(1-acetylazetidin-3-yl)-3,3,3-trifluoropropanamide.
| Compound Name | N-(1-acetylazetidin-3-yl)-3,3,3-trifluoropropanamide |
|---|---|
| PubChem CID | 126789274 |
| Molecular Formula | C8H11F3N2O2 |
| Molecular Weight | 224.18 g/mol |
| Exact Mass | 224.08 |
| IUPAC Name | N-(1-acetylazetidin-3-yl)-3,3,3-trifluoropropanamide |
| SMILES | CC(=O)N1CC(NC(=O)CC(F)(F)F)C1 |
| InChI | InChI=1S/C8H11F3N2O2/c1-5(14)13-3-6(4-13)12-7(15)2-8(9,10)11/h6H,2-4H2,1H3,(H,12,15) |
| InChIKey | NNSUIBJFEASRQJ-UHFFFAOYSA-N |
| XLogP | 0.29 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.18 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |