About trans-(1R,2R)-2-[(4-fluoro-1,3-benzoxazol-2-yl)amino]cyclobutan-1-ol
trans-(1R,2R)-2-[(4-fluoro-1,3-benzoxazol-2-yl)amino]cyclobutan-1-ol (PubChem CID 126790788) has the molecular formula C11H11FN2O2
and a molecular weight of 222.22 g/mol. Its IUPAC name is trans-(1R,2R)-2-[(4-fluoro-1,3-benzoxazol-2-yl)amino]cyclobutan-1-ol.
Molecular Properties
| Compound Name | trans-(1R,2R)-2-[(4-fluoro-1,3-benzoxazol-2-yl)amino]cyclobutan-1-ol |
| PubChem CID | 126790788 |
| Molecular Formula | C11H11FN2O2 |
| Molecular Weight | 222.22 g/mol |
| Exact Mass | 222.08 |
| IUPAC Name | trans-(1R,2R)-2-[(4-fluoro-1,3-benzoxazol-2-yl)amino]cyclobutan-1-ol |
| SMILES | O[C@@H]1CC[C@H]1Nc1nc2c(F)cccc2o1 |
| InChI | InChI=1S/C11H11FN2O2/c12-6-2-1-3-9-10(6)14-11(16-9)13-7-4-5-8(7)15/h1-3,7-8,15H,4-5H2,(H,13,14)/t7-,8-/m1/s1 |
| InChIKey | FAUZDJFJIVZJKK-HTQZYQBOSA-N |
| XLogP | 1.90 |
| TPSA | 58.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 222.22 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze trans-(1R,2R)-2-[(4-fluoro-1,3-benzoxazol-2-yl)amino]cyclobutan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of trans-(1R,2R)-2-[(4-fluoro-1,3-benzoxazol-2-yl)amino]cyclobutan-1-ol?
The IUPAC name of trans-(1R,2R)-2-[(4-fluoro-1,3-benzoxazol-2-yl)amino]cyclobutan-1-ol (CID 126790788) is trans-(1R,2R)-2-[(4-fluoro-1,3-benzoxazol-2-yl)amino]cyclobutan-1-ol.
What is the SMILES notation for trans-(1R,2R)-2-[(4-fluoro-1,3-benzoxazol-2-yl)amino]cyclobutan-1-ol?
The canonical SMILES for trans-(1R,2R)-2-[(4-fluoro-1,3-benzoxazol-2-yl)amino]cyclobutan-1-ol is O[C@@H]1CC[C@H]1Nc1nc2c(F)cccc2o1.
What is the InChIKey of trans-(1R,2R)-2-[(4-fluoro-1,3-benzoxazol-2-yl)amino]cyclobutan-1-ol?
The InChIKey is FAUZDJFJIVZJKK-HTQZYQBOSA-N. The full InChI is InChI=1S/C11H11FN2O2/c12-6-2-1-3-9-10(6)14-11(16-9)13-7-4-5-8(7)15/h1-3,7-8,15H,4-5H2,(H,13,14)/t7-,8-/m1/s1.
What are the key properties of trans-(1R,2R)-2-[(4-fluoro-1,3-benzoxazol-2-yl)amino]cyclobutan-1-ol?
trans-(1R,2R)-2-[(4-fluoro-1,3-benzoxazol-2-yl)amino]cyclobutan-1-ol has a molecular weight of 222.22 g/mol, XLogP of 1.90, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for trans-(1R,2R)-2-[(4-fluoro-1,3-benzoxazol-2-yl)amino]cyclobutan-1-ol is sourced from PubChem (CID 126790788), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).