C10H7FN4O — CID 166224803
4-fluoro-N-(1H-pyrazol-4-yl)-1,3-benzoxazol-2-amine (PubChem CID 166224803) has the molecular formula C10H7FN4O and a molecular weight of 218.19 g/mol. Its IUPAC name is 4-fluoro-N-(1H-pyrazol-4-yl)-1,3-benzoxazol-2-amine.
| Compound Name | 4-fluoro-N-(1H-pyrazol-4-yl)-1,3-benzoxazol-2-amine |
|---|---|
| PubChem CID | 166224803 |
| Molecular Formula | C10H7FN4O |
| Molecular Weight | 218.19 g/mol |
| Exact Mass | 218.06 |
| IUPAC Name | 4-fluoro-N-(1H-pyrazol-4-yl)-1,3-benzoxazol-2-amine |
| SMILES | Fc1cccc2oc(Nc3cn[nH]c3)nc12 |
| InChI | InChI=1S/C10H7FN4O/c11-7-2-1-3-8-9(7)15-10(16-8)14-6-4-12-13-5-6/h1-5H,(H,12,13)(H,14,15) |
| InChIKey | QGJAXIRWTRQTPG-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 66.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.19 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |