C12H23ClN2O2 — CID 126791140
tert-butyl N-(2-azabicyclo[2.2.2]octan-6-yl)carbamate;hydrochloride (PubChem CID 126791140) has the molecular formula C12H23ClN2O2 and a molecular weight of 262.78 g/mol. Its IUPAC name is tert-butyl N-(2-azabicyclo[2.2.2]octan-6-yl)carbamate;hydrochloride.
| Compound Name | tert-butyl N-(2-azabicyclo[2.2.2]octan-6-yl)carbamate;hydrochloride |
|---|---|
| PubChem CID | 126791140 |
| Molecular Formula | C12H23ClN2O2 |
| Molecular Weight | 262.78 g/mol |
| Exact Mass | 262.14 |
| IUPAC Name | tert-butyl N-(2-azabicyclo[2.2.2]octan-6-yl)carbamate;hydrochloride |
| SMILES | CC(C)(C)OC(=O)NC1CC2CCC1NC2.Cl |
| InChI | InChI=1S/C12H22N2O2.ClH/c1-12(2,3)16-11(15)14-10-6-8-4-5-9(10)13-7-8;/h8-10,13H,4-7H2,1-3H3,(H,14,15);1H |
| InChIKey | GRVADUPGAADKKC-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.78 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |