C10H17N3O — CID 126792155
3-(3,5-dimethyl-1H-pyrazol-4-yl)-4-methylmorpholine (PubChem CID 126792155) has the molecular formula C10H17N3O and a molecular weight of 195.27 g/mol. Its IUPAC name is 3-(3,5-dimethyl-1H-pyrazol-4-yl)-4-methylmorpholine.
| Compound Name | 3-(3,5-dimethyl-1H-pyrazol-4-yl)-4-methylmorpholine |
|---|---|
| PubChem CID | 126792155 |
| Molecular Formula | C10H17N3O |
| Molecular Weight | 195.27 g/mol |
| Exact Mass | 195.14 |
| IUPAC Name | 3-(3,5-dimethyl-1H-pyrazol-4-yl)-4-methylmorpholine |
| SMILES | Cc1n[nH]c(C)c1C1COCCN1C |
| InChI | InChI=1S/C10H17N3O/c1-7-10(8(2)12-11-7)9-6-14-5-4-13(9)3/h9H,4-6H2,1-3H3,(H,11,12) |
| InChIKey | JQMKCZGWDNSAIA-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 41.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.27 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |