C12H20FNO — CID 126792350
N-(3-fluorocyclopentyl)-2,2,3-trimethylbut-3-enamide (PubChem CID 126792350) has the molecular formula C12H20FNO and a molecular weight of 213.30 g/mol. Its IUPAC name is N-(3-fluorocyclopentyl)-2,2,3-trimethylbut-3-enamide.
| Compound Name | N-(3-fluorocyclopentyl)-2,2,3-trimethylbut-3-enamide |
|---|---|
| PubChem CID | 126792350 |
| Molecular Formula | C12H20FNO |
| Molecular Weight | 213.30 g/mol |
| Exact Mass | 213.15 |
| IUPAC Name | N-(3-fluorocyclopentyl)-2,2,3-trimethylbut-3-enamide |
| SMILES | C=C(C)C(C)(C)C(=O)NC1CCC(F)C1 |
| InChI | InChI=1S/C12H20FNO/c1-8(2)12(3,4)11(15)14-10-6-5-9(13)7-10/h9-10H,1,5-7H2,2-4H3,(H,14,15) |
| InChIKey | HAQOOWSWGVKINL-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.30 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|