C17H27N5O3 — CID 126802002
4-amino-2-cyclopentyl-N-(2-hydroxy-3-morpholin-4-ylpropyl)pyrimidine-5-carboxamide (PubChem CID 126802002) has the molecular formula C17H27N5O3 and a molecular weight of 349.44 g/mol. Its IUPAC name is 4-amino-2-cyclopentyl-N-(2-hydroxy-3-morpholin-4-ylpropyl)pyrimidine-5-carboxamide.
| Compound Name | 4-amino-2-cyclopentyl-N-(2-hydroxy-3-morpholin-4-ylpropyl)pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 126802002 |
| Molecular Formula | C17H27N5O3 |
| Molecular Weight | 349.44 g/mol |
| Exact Mass | 349.21 |
| IUPAC Name | 4-amino-2-cyclopentyl-N-(2-hydroxy-3-morpholin-4-ylpropyl)pyrimidine-5-carboxamide |
| SMILES | Nc1nc(C2CCCC2)ncc1C(=O)NCC(O)CN1CCOCC1 |
| InChI | InChI=1S/C17H27N5O3/c18-15-14(10-19-16(21-15)12-3-1-2-4-12)17(24)20-9-13(23)11-22-5-7-25-8-6-22/h10,12-13,23H,1-9,11H2,(H,20,24)(H2,18,19,21) |
| InChIKey | UDVYSEOLIBKIDE-UHFFFAOYSA-N |
| XLogP | 0.14 |
| TPSA | 113.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.44 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |