C16H24F3N3O2 — CID 126807373
N-[1-(3,3,3-trifluoropropanoyl)piperidin-4-yl]-1,2,3,5,6,7-hexahydropyrrolizine-8-carboxamide (PubChem CID 126807373) has the molecular formula C16H24F3N3O2 and a molecular weight of 347.38 g/mol. Its IUPAC name is N-[1-(3,3,3-trifluoropropanoyl)piperidin-4-yl]-1,2,3,5,6,7-hexahydropyrrolizine-8-carboxamide.
| Compound Name | N-[1-(3,3,3-trifluoropropanoyl)piperidin-4-yl]-1,2,3,5,6,7-hexahydropyrrolizine-8-carboxamide |
|---|---|
| PubChem CID | 126807373 |
| Molecular Formula | C16H24F3N3O2 |
| Molecular Weight | 347.38 g/mol |
| Exact Mass | 347.18 |
| IUPAC Name | N-[1-(3,3,3-trifluoropropanoyl)piperidin-4-yl]-1,2,3,5,6,7-hexahydropyrrolizine-8-carboxamide |
| SMILES | O=C(CC(F)(F)F)N1CCC(NC(=O)C23CCCN2CCC3)CC1 |
| InChI | InChI=1S/C16H24F3N3O2/c17-16(18,19)11-13(23)21-9-3-12(4-10-21)20-14(24)15-5-1-7-22(15)8-2-6-15/h12H,1-11H2,(H,20,24) |
| InChIKey | SDBPCZGGDMJDFE-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.38 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |