C14H19F3N2O4 — CID 154865673
2-cyclopropyl-3-oxo-3-[[1-(3,3,3-trifluoropropanoyl)piperidin-4-yl]amino]propanoic acid (PubChem CID 154865673) has the molecular formula C14H19F3N2O4 and a molecular weight of 336.31 g/mol. Its IUPAC name is 2-cyclopropyl-3-oxo-3-[[1-(3,3,3-trifluoropropanoyl)piperidin-4-yl]amino]propanoic acid.
| Compound Name | 2-cyclopropyl-3-oxo-3-[[1-(3,3,3-trifluoropropanoyl)piperidin-4-yl]amino]propanoic acid |
|---|---|
| PubChem CID | 154865673 |
| Molecular Formula | C14H19F3N2O4 |
| Molecular Weight | 336.31 g/mol |
| Exact Mass | 336.13 |
| IUPAC Name | 2-cyclopropyl-3-oxo-3-[[1-(3,3,3-trifluoropropanoyl)piperidin-4-yl]amino]propanoic acid |
| SMILES | O=C(O)C(C(=O)NC1CCN(C(=O)CC(F)(F)F)CC1)C1CC1 |
| InChI | InChI=1S/C14H19F3N2O4/c15-14(16,17)7-10(20)19-5-3-9(4-6-19)18-12(21)11(13(22)23)8-1-2-8/h8-9,11H,1-7H2,(H,18,21)(H,22,23) |
| InChIKey | RDMUHVWCTCCMJW-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.31 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|