C17H20N6 — CID 126808103
1-phenyl-N-(5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-3-ylmethyl)-1-(1H-1,2,4-triazol-5-yl)methanamine (PubChem CID 126808103) has the molecular formula C17H20N6 and a molecular weight of 308.39 g/mol. Its IUPAC name is 1-phenyl-N-(5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-3-ylmethyl)-1-(1H-1,2,4-triazol-5-yl)methanamine.
| Compound Name | 1-phenyl-N-(5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-3-ylmethyl)-1-(1H-1,2,4-triazol-5-yl)methanamine |
|---|---|
| PubChem CID | 126808103 |
| Molecular Formula | C17H20N6 |
| Molecular Weight | 308.39 g/mol |
| Exact Mass | 308.17 |
| IUPAC Name | 1-phenyl-N-(5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-3-ylmethyl)-1-(1H-1,2,4-triazol-5-yl)methanamine |
| SMILES | c1ccc(C(NCc2cnc3n2CCCC3)c2ncn[nH]2)cc1 |
| InChI | InChI=1S/C17H20N6/c1-2-6-13(7-3-1)16(17-20-12-21-22-17)19-11-14-10-18-15-8-4-5-9-23(14)15/h1-3,6-7,10,12,16,19H,4-5,8-9,11H2,(H,20,21,22) |
| InChIKey | VEHPUUOSAQRZSA-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 71.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.39 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |