C20H23N3O4 — CID 126815159
methyl N-[2-methyl-3-[[4-(oxolan-3-yl)phenyl]carbamoylamino]phenyl]carbamate (PubChem CID 126815159) has the molecular formula C20H23N3O4 and a molecular weight of 369.42 g/mol. Its IUPAC name is methyl N-[2-methyl-3-[[4-(oxolan-3-yl)phenyl]carbamoylamino]phenyl]carbamate.
| Compound Name | methyl N-[2-methyl-3-[[4-(oxolan-3-yl)phenyl]carbamoylamino]phenyl]carbamate |
|---|---|
| PubChem CID | 126815159 |
| Molecular Formula | C20H23N3O4 |
| Molecular Weight | 369.42 g/mol |
| Exact Mass | 369.17 |
| IUPAC Name | methyl N-[2-methyl-3-[[4-(oxolan-3-yl)phenyl]carbamoylamino]phenyl]carbamate |
| SMILES | COC(=O)Nc1cccc(NC(=O)Nc2ccc(C3CCOC3)cc2)c1C |
| InChI | InChI=1S/C20H23N3O4/c1-13-17(4-3-5-18(13)23-20(25)26-2)22-19(24)21-16-8-6-14(7-9-16)15-10-11-27-12-15/h3-9,15H,10-12H2,1-2H3,(H,23,25)(H2,21,22,24) |
| InChIKey | HHONEPHXVIQWIK-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 88.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.42 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |