About 1-(5-tert-butyl-1,2-oxazol-3-yl)-3-[4-(oxolan-3-yl)phenyl]urea
1-(5-tert-butyl-1,2-oxazol-3-yl)-3-[4-(oxolan-3-yl)phenyl]urea (PubChem CID 166236097) has the molecular formula C18H23N3O3
and a molecular weight of 329.40 g/mol. Its IUPAC name is 1-(5-tert-butyl-1,2-oxazol-3-yl)-3-[4-(oxolan-3-yl)phenyl]urea.
Molecular Properties
| Compound Name | 1-(5-tert-butyl-1,2-oxazol-3-yl)-3-[4-(oxolan-3-yl)phenyl]urea |
| PubChem CID | 166236097 |
| Molecular Formula | C18H23N3O3 |
| Molecular Weight | 329.40 g/mol |
| Exact Mass | 329.17 |
| IUPAC Name | 1-(5-tert-butyl-1,2-oxazol-3-yl)-3-[4-(oxolan-3-yl)phenyl]urea |
| SMILES | CC(C)(C)c1cc(NC(=O)Nc2ccc(C3CCOC3)cc2)no1 |
| InChI | InChI=1S/C18H23N3O3/c1-18(2,3)15-10-16(21-24-15)20-17(22)19-14-6-4-12(5-7-14)13-8-9-23-11-13/h4-7,10,13H,8-9,11H2,1-3H3,(H2,19,20,21,22) |
| InChIKey | XWYYQAXJPQALBN-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 76.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 329.40 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-(5-tert-butyl-1,2-oxazol-3-yl)-3-[4-(oxolan-3-yl)phenyl]urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(5-tert-butyl-1,2-oxazol-3-yl)-3-[4-(oxolan-3-yl)phenyl]urea?
The IUPAC name of 1-(5-tert-butyl-1,2-oxazol-3-yl)-3-[4-(oxolan-3-yl)phenyl]urea (CID 166236097) is 1-(5-tert-butyl-1,2-oxazol-3-yl)-3-[4-(oxolan-3-yl)phenyl]urea.
What is the SMILES notation for 1-(5-tert-butyl-1,2-oxazol-3-yl)-3-[4-(oxolan-3-yl)phenyl]urea?
The canonical SMILES for 1-(5-tert-butyl-1,2-oxazol-3-yl)-3-[4-(oxolan-3-yl)phenyl]urea is CC(C)(C)c1cc(NC(=O)Nc2ccc(C3CCOC3)cc2)no1.
What is the InChIKey of 1-(5-tert-butyl-1,2-oxazol-3-yl)-3-[4-(oxolan-3-yl)phenyl]urea?
The InChIKey is XWYYQAXJPQALBN-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H23N3O3/c1-18(2,3)15-10-16(21-24-15)20-17(22)19-14-6-4-12(5-7-14)13-8-9-23-11-13/h4-7,10,13H,8-9,11H2,1-3H3,(H2,19,20,21,22).
What are the key properties of 1-(5-tert-butyl-1,2-oxazol-3-yl)-3-[4-(oxolan-3-yl)phenyl]urea?
1-(5-tert-butyl-1,2-oxazol-3-yl)-3-[4-(oxolan-3-yl)phenyl]urea has a molecular weight of 329.40 g/mol, XLogP of 4.12, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(5-tert-butyl-1,2-oxazol-3-yl)-3-[4-(oxolan-3-yl)phenyl]urea is sourced from PubChem (CID 166236097), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).