C18H23N3O3 — CID 166236097
1-(5-tert-butyl-1,2-oxazol-3-yl)-3-[4-(oxolan-3-yl)phenyl]urea (PubChem CID 166236097) has the molecular formula C18H23N3O3 and a molecular weight of 329.40 g/mol. Its IUPAC name is 1-(5-tert-butyl-1,2-oxazol-3-yl)-3-[4-(oxolan-3-yl)phenyl]urea.
| Compound Name | 1-(5-tert-butyl-1,2-oxazol-3-yl)-3-[4-(oxolan-3-yl)phenyl]urea |
|---|---|
| PubChem CID | 166236097 |
| Molecular Formula | C18H23N3O3 |
| Molecular Weight | 329.40 g/mol |
| Exact Mass | 329.17 |
| IUPAC Name | 1-(5-tert-butyl-1,2-oxazol-3-yl)-3-[4-(oxolan-3-yl)phenyl]urea |
| SMILES | CC(C)(C)c1cc(NC(=O)Nc2ccc(C3CCOC3)cc2)no1 |
| InChI | InChI=1S/C18H23N3O3/c1-18(2,3)15-10-16(21-24-15)20-17(22)19-14-6-4-12(5-7-14)13-8-9-23-11-13/h4-7,10,13H,8-9,11H2,1-3H3,(H2,19,20,21,22) |
| InChIKey | XWYYQAXJPQALBN-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 76.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.40 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |