C16H23NO5S — CID 126819068
methyl 2-[5-methoxy-2-(2-methylpiperidin-1-yl)sulfonylphenyl]acetate (PubChem CID 126819068) has the molecular formula C16H23NO5S and a molecular weight of 341.43 g/mol. Its IUPAC name is methyl 2-[5-methoxy-2-(2-methylpiperidin-1-yl)sulfonylphenyl]acetate.
| Compound Name | methyl 2-[5-methoxy-2-(2-methylpiperidin-1-yl)sulfonylphenyl]acetate |
|---|---|
| PubChem CID | 126819068 |
| Molecular Formula | C16H23NO5S |
| Molecular Weight | 341.43 g/mol |
| Exact Mass | 341.13 |
| IUPAC Name | methyl 2-[5-methoxy-2-(2-methylpiperidin-1-yl)sulfonylphenyl]acetate |
| SMILES | COC(=O)Cc1cc(OC)ccc1S(=O)(=O)N1CCCCC1C |
| InChI | InChI=1S/C16H23NO5S/c1-12-6-4-5-9-17(12)23(19,20)15-8-7-14(21-2)10-13(15)11-16(18)22-3/h7-8,10,12H,4-6,9,11H2,1-3H3 |
| InChIKey | SCRPFVYPYSXBNU-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.43 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |