C15H19N5O3 — CID 126820412
methyl 1-methyl-5-[2-(3-methyl-4-pyridinyl)ethylcarbamoylamino]pyrazole-4-carboxylate (PubChem CID 126820412) has the molecular formula C15H19N5O3 and a molecular weight of 317.35 g/mol. Its IUPAC name is methyl 1-methyl-5-[2-(3-methyl-4-pyridinyl)ethylcarbamoylamino]pyrazole-4-carboxylate.
| Compound Name | methyl 1-methyl-5-[2-(3-methyl-4-pyridinyl)ethylcarbamoylamino]pyrazole-4-carboxylate |
|---|---|
| PubChem CID | 126820412 |
| Molecular Formula | C15H19N5O3 |
| Molecular Weight | 317.35 g/mol |
| Exact Mass | 317.15 |
| IUPAC Name | methyl 1-methyl-5-[2-(3-methyl-4-pyridinyl)ethylcarbamoylamino]pyrazole-4-carboxylate |
| SMILES | COC(=O)c1cnn(C)c1NC(=O)NCCc1ccncc1C |
| InChI | InChI=1S/C15H19N5O3/c1-10-8-16-6-4-11(10)5-7-17-15(22)19-13-12(14(21)23-3)9-18-20(13)2/h4,6,8-9H,5,7H2,1-3H3,(H2,17,19,22) |
| InChIKey | ZFODZPMEFYGLPT-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 98.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.35 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |