C18H26N4O2 — CID 126824690
tert-butyl 1-methyl-5-[[2-(3-methyl-4-pyridinyl)ethylamino]methyl]pyrazole-4-carboxylate (PubChem CID 126824690) has the molecular formula C18H26N4O2 and a molecular weight of 330.43 g/mol. Its IUPAC name is tert-butyl 1-methyl-5-[[2-(3-methyl-4-pyridinyl)ethylamino]methyl]pyrazole-4-carboxylate.
| Compound Name | tert-butyl 1-methyl-5-[[2-(3-methyl-4-pyridinyl)ethylamino]methyl]pyrazole-4-carboxylate |
|---|---|
| PubChem CID | 126824690 |
| Molecular Formula | C18H26N4O2 |
| Molecular Weight | 330.43 g/mol |
| Exact Mass | 330.21 |
| IUPAC Name | tert-butyl 1-methyl-5-[[2-(3-methyl-4-pyridinyl)ethylamino]methyl]pyrazole-4-carboxylate |
| SMILES | Cc1cnccc1CCNCc1c(C(=O)OC(C)(C)C)cnn1C |
| InChI | InChI=1S/C18H26N4O2/c1-13-10-19-8-6-14(13)7-9-20-12-16-15(11-21-22(16)5)17(23)24-18(2,3)4/h6,8,10-11,20H,7,9,12H2,1-5H3 |
| InChIKey | LJCCCLRKYBGUQS-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 69.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.43 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|