C16H20N4O2S — CID 126820977
methyl 5-[(2-pyrrolidin-1-yl-2-thiophen-2-ylethyl)amino]pyrazine-2-carboxylate (PubChem CID 126820977) has the molecular formula C16H20N4O2S and a molecular weight of 332.43 g/mol. Its IUPAC name is methyl 5-[(2-pyrrolidin-1-yl-2-thiophen-2-ylethyl)amino]pyrazine-2-carboxylate.
| Compound Name | methyl 5-[(2-pyrrolidin-1-yl-2-thiophen-2-ylethyl)amino]pyrazine-2-carboxylate |
|---|---|
| PubChem CID | 126820977 |
| Molecular Formula | C16H20N4O2S |
| Molecular Weight | 332.43 g/mol |
| Exact Mass | 332.13 |
| IUPAC Name | methyl 5-[(2-pyrrolidin-1-yl-2-thiophen-2-ylethyl)amino]pyrazine-2-carboxylate |
| SMILES | COC(=O)c1cnc(NCC(c2cccs2)N2CCCC2)cn1 |
| InChI | InChI=1S/C16H20N4O2S/c1-22-16(21)12-9-18-15(11-17-12)19-10-13(14-5-4-8-23-14)20-6-2-3-7-20/h4-5,8-9,11,13H,2-3,6-7,10H2,1H3,(H,18,19) |
| InChIKey | CULKRNIAYKWIMD-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 67.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.43 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |