C9H9ClF3N3O3S — CID 126822944
2-[[6-chloro-5-(trifluoromethyl)-3-pyridinyl]sulfonylamino]propanamide (PubChem CID 126822944) has the molecular formula C9H9ClF3N3O3S and a molecular weight of 331.70 g/mol. Its IUPAC name is 2-[[6-chloro-5-(trifluoromethyl)-3-pyridinyl]sulfonylamino]propanamide.
| Compound Name | 2-[[6-chloro-5-(trifluoromethyl)-3-pyridinyl]sulfonylamino]propanamide |
|---|---|
| PubChem CID | 126822944 |
| Molecular Formula | C9H9ClF3N3O3S |
| Molecular Weight | 331.70 g/mol |
| Exact Mass | 331.00 |
| IUPAC Name | 2-[[6-chloro-5-(trifluoromethyl)-3-pyridinyl]sulfonylamino]propanamide |
| SMILES | CC(NS(=O)(=O)c1cnc(Cl)c(C(F)(F)F)c1)C(N)=O |
| InChI | InChI=1S/C9H9ClF3N3O3S/c1-4(8(14)17)16-20(18,19)5-2-6(9(11,12)13)7(10)15-3-5/h2-4,16H,1H3,(H2,14,17) |
| InChIKey | KJPSFGPAVGYYCW-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 102.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.70 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|