C19H19ClFN3O — CID 126825136
N-[2-(5-chloro-6-fluoro-1H-indol-3-yl)ethyl]-2-(5-ethyl-2-pyridinyl)acetamide (PubChem CID 126825136) has the molecular formula C19H19ClFN3O and a molecular weight of 359.83 g/mol. Its IUPAC name is N-[2-(5-chloro-6-fluoro-1H-indol-3-yl)ethyl]-2-(5-ethyl-2-pyridinyl)acetamide.
| Compound Name | N-[2-(5-chloro-6-fluoro-1H-indol-3-yl)ethyl]-2-(5-ethyl-2-pyridinyl)acetamide |
|---|---|
| PubChem CID | 126825136 |
| Molecular Formula | C19H19ClFN3O |
| Molecular Weight | 359.83 g/mol |
| Exact Mass | 359.12 |
| IUPAC Name | N-[2-(5-chloro-6-fluoro-1H-indol-3-yl)ethyl]-2-(5-ethyl-2-pyridinyl)acetamide |
| SMILES | CCc1ccc(CC(=O)NCCc2c[nH]c3cc(F)c(Cl)cc23)nc1 |
| InChI | InChI=1S/C19H19ClFN3O/c1-2-12-3-4-14(23-10-12)7-19(25)22-6-5-13-11-24-18-9-17(21)16(20)8-15(13)18/h3-4,8-11,24H,2,5-7H2,1H3,(H,22,25) |
| InChIKey | KCAPXQFDCJOVJU-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.83 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |