C17H25NO3S — CID 126829423
N-[(1,1-dioxothietan-3-yl)methyl]-3-(4-propan-2-ylphenyl)butanamide (PubChem CID 126829423) has the molecular formula C17H25NO3S and a molecular weight of 323.46 g/mol. Its IUPAC name is N-[(1,1-dioxothietan-3-yl)methyl]-3-(4-propan-2-ylphenyl)butanamide.
| Compound Name | N-[(1,1-dioxothietan-3-yl)methyl]-3-(4-propan-2-ylphenyl)butanamide |
|---|---|
| PubChem CID | 126829423 |
| Molecular Formula | C17H25NO3S |
| Molecular Weight | 323.46 g/mol |
| Exact Mass | 323.16 |
| IUPAC Name | N-[(1,1-dioxothietan-3-yl)methyl]-3-(4-propan-2-ylphenyl)butanamide |
| SMILES | CC(C)c1ccc(C(C)CC(=O)NCC2CS(=O)(=O)C2)cc1 |
| InChI | InChI=1S/C17H25NO3S/c1-12(2)15-4-6-16(7-5-15)13(3)8-17(19)18-9-14-10-22(20,21)11-14/h4-7,12-14H,8-11H2,1-3H3,(H,18,19) |
| InChIKey | CPUXMNRGKBGMFC-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.46 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |