C15H25N3O3S — CID 126830232
N-[2-(dimethylamino)ethyl]-2-[(2-ethylphenyl)sulfonylamino]propanamide (PubChem CID 126830232) has the molecular formula C15H25N3O3S and a molecular weight of 327.45 g/mol. Its IUPAC name is N-[2-(dimethylamino)ethyl]-2-[(2-ethylphenyl)sulfonylamino]propanamide.
| Compound Name | N-[2-(dimethylamino)ethyl]-2-[(2-ethylphenyl)sulfonylamino]propanamide |
|---|---|
| PubChem CID | 126830232 |
| Molecular Formula | C15H25N3O3S |
| Molecular Weight | 327.45 g/mol |
| Exact Mass | 327.16 |
| IUPAC Name | N-[2-(dimethylamino)ethyl]-2-[(2-ethylphenyl)sulfonylamino]propanamide |
| SMILES | CCc1ccccc1S(=O)(=O)NC(C)C(=O)NCCN(C)C |
| InChI | InChI=1S/C15H25N3O3S/c1-5-13-8-6-7-9-14(13)22(20,21)17-12(2)15(19)16-10-11-18(3)4/h6-9,12,17H,5,10-11H2,1-4H3,(H,16,19) |
| InChIKey | MVNUIRDNPKZFIJ-UHFFFAOYSA-N |
| XLogP | 0.59 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.45 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |