About 4-[[5-(1,3-benzothiazol-2-yl)furan-2-yl]methyl]morpholine-3-carboxamide
4-[[5-(1,3-benzothiazol-2-yl)furan-2-yl]methyl]morpholine-3-carboxamide (PubChem CID 126833697) has the molecular formula C17H17N3O3S
and a molecular weight of 343.41 g/mol. Its IUPAC name is 4-[[5-(1,3-benzothiazol-2-yl)furan-2-yl]methyl]morpholine-3-carboxamide.
Molecular Properties
| Compound Name | 4-[[5-(1,3-benzothiazol-2-yl)furan-2-yl]methyl]morpholine-3-carboxamide |
| PubChem CID | 126833697 |
| Molecular Formula | C17H17N3O3S |
| Molecular Weight | 343.41 g/mol |
| Exact Mass | 343.10 |
| IUPAC Name | 4-[[5-(1,3-benzothiazol-2-yl)furan-2-yl]methyl]morpholine-3-carboxamide |
| SMILES | NC(=O)C1COCCN1Cc1ccc(-c2nc3ccccc3s2)o1 |
| InChI | InChI=1S/C17H17N3O3S/c18-16(21)13-10-22-8-7-20(13)9-11-5-6-14(23-11)17-19-12-3-1-2-4-15(12)24-17/h1-6,13H,7-10H2,(H2,18,21) |
| InChIKey | OBYMWPMISSVRKJ-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 81.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 343.41 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 4-[[5-(1,3-benzothiazol-2-yl)furan-2-yl]methyl]morpholine-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[[5-(1,3-benzothiazol-2-yl)furan-2-yl]methyl]morpholine-3-carboxamide?
The IUPAC name of 4-[[5-(1,3-benzothiazol-2-yl)furan-2-yl]methyl]morpholine-3-carboxamide (CID 126833697) is 4-[[5-(1,3-benzothiazol-2-yl)furan-2-yl]methyl]morpholine-3-carboxamide.
What is the SMILES notation for 4-[[5-(1,3-benzothiazol-2-yl)furan-2-yl]methyl]morpholine-3-carboxamide?
The canonical SMILES for 4-[[5-(1,3-benzothiazol-2-yl)furan-2-yl]methyl]morpholine-3-carboxamide is NC(=O)C1COCCN1Cc1ccc(-c2nc3ccccc3s2)o1.
What is the InChIKey of 4-[[5-(1,3-benzothiazol-2-yl)furan-2-yl]methyl]morpholine-3-carboxamide?
The InChIKey is OBYMWPMISSVRKJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H17N3O3S/c18-16(21)13-10-22-8-7-20(13)9-11-5-6-14(23-11)17-19-12-3-1-2-4-15(12)24-17/h1-6,13H,7-10H2,(H2,18,21).
What are the key properties of 4-[[5-(1,3-benzothiazol-2-yl)furan-2-yl]methyl]morpholine-3-carboxamide?
4-[[5-(1,3-benzothiazol-2-yl)furan-2-yl]methyl]morpholine-3-carboxamide has a molecular weight of 343.41 g/mol, XLogP of 2.24, 4 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[[5-(1,3-benzothiazol-2-yl)furan-2-yl]methyl]morpholine-3-carboxamide is sourced from PubChem (CID 126833697), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).