C12H11F4NO3 — CID 126834056
2,2,3,3-tetrafluoropropyl 4-oxo-4-pyridin-3-ylbutanoate (PubChem CID 126834056) has the molecular formula C12H11F4NO3 and a molecular weight of 293.22 g/mol. Its IUPAC name is 2,2,3,3-tetrafluoropropyl 4-oxo-4-pyridin-3-ylbutanoate.
| Compound Name | 2,2,3,3-tetrafluoropropyl 4-oxo-4-pyridin-3-ylbutanoate |
|---|---|
| PubChem CID | 126834056 |
| Molecular Formula | C12H11F4NO3 |
| Molecular Weight | 293.22 g/mol |
| Exact Mass | 293.07 |
| IUPAC Name | 2,2,3,3-tetrafluoropropyl 4-oxo-4-pyridin-3-ylbutanoate |
| SMILES | O=C(CCC(=O)c1cccnc1)OCC(F)(F)C(F)F |
| InChI | InChI=1S/C12H11F4NO3/c13-11(14)12(15,16)7-20-10(19)4-3-9(18)8-2-1-5-17-6-8/h1-2,5-6,11H,3-4,7H2 |
| InChIKey | KWYJAJJSFLACGL-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 56.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.22 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|