C12H20ClNO2 — CID 126834278
1-(5-chloro-3,6-dihydro-2H-pyridin-1-yl)-2-pentoxyethanone (PubChem CID 126834278) has the molecular formula C12H20ClNO2 and a molecular weight of 245.75 g/mol. Its IUPAC name is 1-(5-chloro-3,6-dihydro-2H-pyridin-1-yl)-2-pentoxyethanone.
| Compound Name | 1-(5-chloro-3,6-dihydro-2H-pyridin-1-yl)-2-pentoxyethanone |
|---|---|
| PubChem CID | 126834278 |
| Molecular Formula | C12H20ClNO2 |
| Molecular Weight | 245.75 g/mol |
| Exact Mass | 245.12 |
| IUPAC Name | 1-(5-chloro-3,6-dihydro-2H-pyridin-1-yl)-2-pentoxyethanone |
| SMILES | CCCCCOCC(=O)N1CCC=C(Cl)C1 |
| InChI | InChI=1S/C12H20ClNO2/c1-2-3-4-8-16-10-12(15)14-7-5-6-11(13)9-14/h6H,2-5,7-10H2,1H3 |
| InChIKey | GPQWIFDLXGSEAQ-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.75 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|