C15H21N3O2 — CID 126840217
1-(4,4-dimethyl-2-oxopyrrolidin-3-yl)-3-(2,6-dimethylphenyl)urea (PubChem CID 126840217) has the molecular formula C15H21N3O2 and a molecular weight of 275.35 g/mol. Its IUPAC name is 1-(4,4-dimethyl-2-oxopyrrolidin-3-yl)-3-(2,6-dimethylphenyl)urea.
| Compound Name | 1-(4,4-dimethyl-2-oxopyrrolidin-3-yl)-3-(2,6-dimethylphenyl)urea |
|---|---|
| PubChem CID | 126840217 |
| Molecular Formula | C15H21N3O2 |
| Molecular Weight | 275.35 g/mol |
| Exact Mass | 275.16 |
| IUPAC Name | 1-(4,4-dimethyl-2-oxopyrrolidin-3-yl)-3-(2,6-dimethylphenyl)urea |
| SMILES | Cc1cccc(C)c1NC(=O)NC1C(=O)NCC1(C)C |
| InChI | InChI=1S/C15H21N3O2/c1-9-6-5-7-10(2)11(9)17-14(20)18-12-13(19)16-8-15(12,3)4/h5-7,12H,8H2,1-4H3,(H,16,19)(H2,17,18,20) |
| InChIKey | LXUKBZGSRFRIKR-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.35 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |